RefMet Compound Details
MW structure | 35291 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 2-Hydroxyestrone | |
Systematic name | 2,3-dihydroxy-estra-1,3,5(10)-trien-17-one | |
SMILES | C[C@]12CC[C@H]3[C@@H](CCc4cc(c(cc34)O)O)[C@@H]1CCC2=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 18:4;O3 | View other entries in RefMet with this sum composition |
Exact mass | 286.156895 (neutral) |
Table of KEGG reactions in human pathways involving 2-Hydroxyestrone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04762 | 2-Hydroxyestrone + S-Adenosyl-L-methionine <=> 2-Methoxyestrone + S-Adenosyl-L-homocysteine | S-adenosyl-L-methionine:2-Hydroxyestrone O-methyltransferase |
R02354 | Estrone + H+ + Oxygen + NADH <=> 2-Hydroxyestrone + NAD+ + H2O | Estrone + H+ + Oxygen + NADH <=> 2-Hydroxyestrone + NAD+ + H2O |
R02355 | Estrone + H+ + Oxygen + NADPH <=> 2-Hydroxyestrone + NADP+ + H2O | Estrone + H+ + Oxygen + NADPH <=> 2-Hydroxyestrone + NADP+ + H2O |
Table of KEGG human pathways containing 2-Hydroxyestrone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |