RefMet Compound Details
RefMet ID | RM0158402 | |
---|---|---|
MW structure | 35474 (View MW Metabolite Database details) | |
RefMet name | 21-Hydroxy-5beta-pregnane-3,11,20-trione | |
Systematic name | (8S,9S,10S,13S,14S)-17-(2-hydroxyacetyl)-10,13-dimethyl-2,4,5,6,7,8,9,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,11-dione | |
SMILES | C[C@]12CCC(=O)C[C@H]1CC[C@H]1[C@@H]3CCC(C(=O)CO)[C@@]3(C)CC(=O)[C@H]21 Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:3;O4 | View other entries in RefMet with this sum composition |
Exact mass | 346.214410 (neutral) |
Table of KEGG reactions in human pathways involving 21-Hydroxy-5beta-pregnane-3,11,20-trione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04842 | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione + NAD+ <=> 21-Hydroxy-5beta-pregnane-3,11,20-trione + NADH + H+ | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione:NAD+ oxidoreductase (B-specific) |
R04843 | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione + NADP+ <=> 21-Hydroxy-5beta-pregnane-3,11,20-trione + NADPH + H+ | 3alpha,21-Dihydroxy-5beta-pregnane-11,20-dione:NADP+ oxidoreductase (B-specific) |
Table of KEGG human pathways containing 21-Hydroxy-5beta-pregnane-3,11,20-trione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |