RefMet Compound Details
MW structure | 35332 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5alpha-Dihydrotesosterone | |
Systematic name | 17beta-hydroxy-androstan-3-one | |
SMILES | C[C@]12CCC(=O)C[C@@H]1CC[C@H]1[C@@H]3CC[C@@H]([C@@]3(C)CC[C@H]21)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 19:1;O2 | View other entries in RefMet with this sum composition |
Exact mass | 290.224580 (neutral) |
Table of KEGG reactions in human pathways involving 5alpha-Dihydrotesosterone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08963 | Dihydrotestosterone + NADPH + H+ <=> Androstan-3alpha,17beta-diol + NADP+ | Androstan-3alpha,17beta-diol:NADP+ oxidoreductase |
R02497 | Dihydrotestosterone + NADP+ <=> Testosterone + NADPH + H+ | dihydrotestosterone:NADP+ delta4-oxidoreductase |
Table of KEGG human pathways containing 5alpha-Dihydrotesosterone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |