RefMet Compound Details
MW structure | 35449 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 5alpha-Pregnane-3,20-dione | |
Systematic name | 5alpha-pregnane-3,20-dione | |
SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Sum Composition | ST 21:2;O2 | View other entries in RefMet with this sum composition |
Exact mass | 316.240230 (neutral) |
Table of KEGG reactions in human pathways involving 5alpha-Pregnane-3,20-dione
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R08957 | 5alpha-Pregnane-3,20-dione + NADPH + H+ <=> Allopregnanolone + NADP+ | 3alpha-hydroxy-5alpha-pregnan-20-one:NADP+ 3-oxidoreductase (A-specific) |
R08958 | 5alpha-Pregnan-20alpha-ol-3-one + NADP+ <=> 5alpha-Pregnane-3,20-dione + NADPH + H+ | 5alpha-pregnan-20alpha-ol-3-one:NADP+ 20-oxidoreductase |
R02208 | 5alpha-Pregnane-3,20-dione + NADP+ <=> Progesterone + NADPH + H+ | 5alpha-pregnane-3,20-dione:NADP+ delta4-oxidoreductase |
Table of KEGG human pathways containing 5alpha-Pregnane-3,20-dione
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 3 |