RefMet Compound Details
MW structure | 41122 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | 7-Methyluric acid | |
Systematic name | 7-methyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione | |
SMILES | Cn1c2c([nH]c(=O)[nH]c2=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 182.043991 (neutral) |
Table of KEGG reactions in human pathways involving 7-Methyluric acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07979 | 7-Methylxanthine + Oxygen + H2O <=> 7-Methyluric acid + Hydrogen peroxide | 7-methylxanthine:oxygen oxidoreductase |
Table of KEGG human pathways containing 7-Methyluric acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00232 | Caffeine metabolism | 1 |