RefMet Compound Details
MW structure | 51390 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Amygdalin | |
Systematic name | [(6-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy](phenyl)acetonitrile | |
SMILES | c1ccc(cc1)C(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O1)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 457.158411 (neutral) |
Table of KEGG reactions in human pathways involving Amygdalin
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02985 | Prunasin + D-Glucose <=> Amygdalin + H2O | amygdalin beta-glucosidase |
Table of KEGG human pathways containing Amygdalin
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa01100 | Metabolic pathways | 1 |