RefMet Compound Details
MW structure | 37863 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | CDP | |
Systematic name | [({[(2R,3S,4R,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid | |
SMILES | c1cn([C@H]2[C@@H]([C@@H]([C@@H](COP(=O)(O)OP(=O)(O)O)O2)O)O)c(=O)nc1N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 403.018188 (neutral) |
Table of KEGG reactions in human pathways involving CDP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00512 | ATP + CMP <=> ADP + CDP | ATP:CMP phosphotransferase |
R00570 | ATP + CDP <=> ADP + CTP | ATP:CDP phosphotransferase |
R00514 | CDP + H2O <=> CMP + Orthophosphate | CDP phosphohydrolase |
R00569 | CTP + H2O <=> CDP + Orthophosphate | CTP phosphohydrolase |
R02024 | dCDP + Thioredoxin disulfide + H2O <=> Thioredoxin + CDP | 2'-Deoxycytidine diphosphate:oxidized-thioredoxin 2'-oxidoreductase |
Table of KEGG human pathways containing CDP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 5 |