RefMet Compound Details
MW structure | 37665 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Diadenosine tetraphosphate | |
Systematic name | {[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}({[({[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)(hydroxy)phosphoryl]oxy})phosphinic acid | |
SMILES | C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 836.048265 (neutral) |
Table of KEGG reactions in human pathways involving Diadenosine tetraphosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00184 | P1,P4-Bis(5'-adenosyl)tetraphosphate + H2O <=> ATP + AMP | P1,P4-bis(5'-adenosyl)-tetraphosphate adenylohydrolase |
Table of KEGG human pathways containing Diadenosine tetraphosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 1 |