RefMet Compound Details
MW structure | 53606 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | GDP-beta-L-fucose | |
Systematic name | guanosine 5'-[3-(6-deoxy-beta-L-galactopyranosyl) dihydrogen diphosphate] | |
SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)OP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@H](n2cnc3c2nc(N)[nH]c3=O)O1)O)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 589.082246 (neutral) |
Table of KEGG reactions in human pathways involving GDP-beta-L-fucose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01951 | GTP + L-Fucose 1-phosphate <=> Diphosphate + GDP-L-fucose | GTP:beta-L-fucose-1-phosphate guanylyltransferase |
R05692 | GDP-L-fucose + NADP+ <=> GDP-4-dehydro-6-deoxy-D-mannose + NADPH + H+ | GDP-L-fucose:NADP+ 4-oxidoreductase (3,5-epimerizing) |
Table of KEGG human pathways containing GDP-beta-L-fucose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00051 | Fructose and mannose metabolism | 2 |
hsa00520 | Amino sugar and nucleotide sugar metabolism | 2 |