RefMet Compound Details
MW structure | 37368 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Heparan sulfate | |
Systematic name | (2S,3R,4R,5S,6R)-4-hydroxy-3-methoxy-6-{[(2S,3R,4S,5S,6R)-6-methoxy-4-oxido-5-[(sulfooxy)amino]-2-[(sulfooxy)methyl]oxan-3-yl]oxy}-5-(sulfooxy)oxane-2-carboxylate | |
SMILES | CO[C@@H]1[C@H]([C@@H]([C@H](O[C@H]2[C@H](COS(=O)(=O)O)O[C@H]([C@H]([C@@H]2[O-])NOS(=O)(=O)O)OC)O[C@@H]1C(=O)[O-])OS(=O)(=O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 636.992469 (neutral) |
Table of KEGG reactions in human pathways involving Heparan sulfate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R07811 | Heparan sulfate + H2O <=> Heparan sulfate + G13034 | Heparan sulfate + H2O <=> Heparan sulfate + G13034 |
Table of KEGG human pathways containing Heparan sulfate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00531 | Glycosaminoglycan degradation | 1 |