RefMet Compound Details
MW structure | 37119 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Histidine | |
Systematic name | (2S)-2-amino-3-(1H-imidazol-4-yl)propanoic acid | |
SMILES | C(c1c[nH]cn1)[C@@H](C(=O)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 155.069477 (neutral) |
Table of KEGG reactions in human pathways involving Histidine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01164 | ATP + L-Histidine + beta-Alanine <=> ADP + Orthophosphate + Carnosine | L-histidine:beta-alanine ligase (ADP-forming) |
R01166 | Carnosine + H2O <=> beta-Alanine + L-Histidine | Nalpha-(beta-alanyl)-L-histidine hydrolase |
R01167 | L-Histidine <=> Histamine + CO2 | L-histidine carboxy-lyase (histamine-forming) |
R01168 | L-Histidine <=> Urocanate + Ammonia | L-histidine ammonia-lyase (urocanate-forming) |
R03655 | ATP + L-Histidine + tRNA(His) <=> AMP + Diphosphate + L-Histidyl-tRNA(His) | L-Histidine:tRNA(His) ligase (AMP-forming) |
Table of KEGG human pathways containing Histidine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00340 | Histidine metabolism | 2 |
hsa00970 | Aminoacyl-tRNA biosynthesis | 1 |