RefMet Compound Details
MW structure | 41433 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Hydroxykynurenine | |
Systematic name | (2S)-2-amino-4-(2-amino-3-hydroxyphenyl)-4-oxobutanoic acid | |
SMILES | c1cc(C(=O)C[C@@H](C(=O)O)N)c(c(c1)O)N Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 224.079708 (neutral) |
Table of KEGG reactions in human pathways involving Hydroxykynurenine
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01960 | L-Kynurenine + Oxygen + NADPH + H+ <=> 3-Hydroxy-L-kynurenine + NADP+ + H2O | L-Kynurenine,NADPH:oxygen oxidoreductase (3-hydroxylating) |
R02668 | 3-Hydroxy-L-kynurenine + H2O <=> 3-Hydroxyanthranilate + L-Alanine | 3-Hydroxy-L-kynurenine hydrolase |
R04171 | 3-Hydroxy-L-kynurenine + 2-Oxoglutarate <=> 4-(2-Amino-3-hydroxyphenyl)-2,4-dioxobutanoate + L-Glutamate | 3-Hydroxy-L-kynurenine:2-oxoglutarate aminotransferase |
Table of KEGG human pathways containing Hydroxykynurenine
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00380 | Tryptophan metabolism | 3 |