RefMet Compound Details
MW structure | 49834 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | IDP | |
Systematic name | [(2R,3S,4R,5R)-3,4-bis(oxidanyl)-5-(6-oxidanylidene-3H-purin-9-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate | |
SMILES | C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c2[nH]cnc3=O)O1)O)O)OP(=O)(O)OP(=O)(O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 428.013437 (neutral) |
Table of KEGG reactions in human pathways involving IDP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R00722 | ATP + IDP <=> ADP + ITP | ATP:IDP phosphotransferase |
R00961 | IDP + H2O <=> IMP + Orthophosphate | IDP phosphohydrolase |
R00719 | ITP + H2O <=> IDP + Orthophosphate | ITP phosphohydrolase |
Table of KEGG human pathways containing IDP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00230 | Purine metabolism | 3 |