RefMet Compound Details
RefMet ID | RM0034560 | |
---|---|---|
MW structure | 37044 (View MW Metabolite Database details) | |
RefMet name | Melibiose | |
Systematic name | alpha-D-galactopyranosyl-1-6-D-glucopyranose | |
SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](OC[C@@H]2[C@H]([C@@H]([C@H](C(O)O2)O)O)O)O1)O)O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 342.116215 (neutral) |
Table of KEGG reactions in human pathways involving Melibiose
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R01101 | Melibiose + H2O <=> D-Galactose + D-Glucose | melibiose galactohydrolase |
Table of KEGG human pathways containing Melibiose
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00052 | Galactose metabolism | 1 |