RefMet Compound Details
MW structure | 37580 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Acetyl-glucosamine 6-phosphate | |
Systematic name | {[(2R,3S,4R,5R)-5-acetamido-3,4,6-trihydroxyoxan-2-yl]methoxy}phosphonic acid | |
SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@@H](COP(=O)(O)O)OC1O)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 301.056272 (neutral) |
Table of KEGG reactions in human pathways involving N-Acetyl-glucosamine 6-phosphate
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02058 | Acetyl-CoA + D-Glucosamine 6-phosphate <=> CoA + N-Acetyl-D-glucosamine 6-phosphate | acetyl-CoA:D-glucosamine-6-phosphate N-acetyltransferase |
R08193 | N-Acetyl-D-glucosamine 6-phosphate <=> N-Acetyl-alpha-D-glucosamine 1-phosphate | N-Acetyl-D-glucosamine 1-phosphate 1,6-phosphomutase |
R01201 | ATP + N-Acetyl-D-glucosamine <=> ADP + N-Acetyl-D-glucosamine 6-phosphate | ATP:N-acetyl-D-glucosamine 6-phosphotransferase |
R02059 | N-Acetyl-D-glucosamine 6-phosphate + H2O <=> D-Glucosamine 6-phosphate + Acetate | N-Acetyl-D-glucosamine-6-phosphate amidohydrolase |
Table of KEGG human pathways containing N-Acetyl-glucosamine 6-phosphate
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 4 |