RefMet Compound Details
MW structure | 37455 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | N-Glycolylneuraminic acid | |
Systematic name | (2S,4S,5R,6R)-2,4-dihydroxy-5-(2-hydroxyacetamido)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid | |
SMILES | C1[C@@H]([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O[C@@]1(C(=O)O)O)NC(=O)CO)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 325.100896 (neutral) |
Table of KEGG reactions in human pathways involving N-Glycolylneuraminic acid
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04215 | CTP + N-Glycoloyl-neuraminate <=> Diphosphate + CMP-N-glycoloylneuraminate | CTP:N-glycoloylneuraminate cytidylyltransferase |
Table of KEGG human pathways containing N-Glycolylneuraminic acid
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00520 | Amino sugar and nucleotide sugar metabolism | 1 |