RefMet Compound Details
MW structure | 37493 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | Tetrahydrocortisone | |
Systematic name | (1S,2S,5S,7S,10S,11S,14R,15S)-5,14-dihydroxy-14-(2-hydroxyacetyl)-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-17-one | |
SMILES | C[C@]12CC[C@@H](C[C@@H]1CC[C@H]1[C@@H]3CC[C@](C(=O)CO)([C@@]3(C)CC(=O)[C@H]21)O)O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 364.224975 (neutral) |
Table of KEGG reactions in human pathways involving Tetrahydrocortisone
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R04830 | 17alpha,21-Dihydroxy-5beta-pregnane-3,11,20-trione + H+ + NADPH <=> Tetrahydrocortisone + NADP+ | Urocortisone:NADP+ oxidoreductase (B-specific) |
R04829 | Tetrahydrocortisone + NAD+ <=> 17alpha,21-Dihydroxy-5beta-pregnane-3,11,20-trione + NADH + H+ | Urocortisone:NAD+ oxidoreductase (B-specific) |
Table of KEGG human pathways containing Tetrahydrocortisone
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00140 | Steroid hormone biosynthesis | 2 |