RefMet Compound Details
MW structure | 37540 (View MW Metabolite Database details) | |
---|---|---|
RefMet name | dUDP | |
Systematic name | [({[(2R,3S,5R)-5-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]phosphonic acid | |
SMILES | c1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)OP(=O)(O)O)O2)O)c(=O)[nH]c1=O Run Tanimoto similarity search (with similarity coefficient >=0.6) | |
Exact mass | 388.007289 (neutral) |
Table of KEGG reactions in human pathways involving dUDP
Rxn ID | KEGG Reaction | Enzyme |
---|---|---|
R02331 | ATP + dUDP <=> ADP + dUTP | ATP:dUDP phosphotransferase |
R02098 | ATP + dUMP <=> ADP + dUDP | ATP:dUMP phosphotransferase |
R02330 | dUTP + H2O <=> dUDP + Orthophosphate | dUTP nucleotidohydrolase |
R02018 | dUDP + Thioredoxin disulfide + H2O <=> Thioredoxin + UDP | 2'-Deoxyuridine 5'-diphosphate:oxidized-thioredoxin 2'-oxidoreductase |
Table of KEGG human pathways containing dUDP
Pathway ID | Human Pathway | # of reactions |
---|---|---|
hsa00240 | Pyrimidine metabolism | 3 |
hsa01100 | Metabolic pathways | 1 |